C25H33N7O6 — CID 171513552
tert-butyl (1S,6S)-5-[(10R,12S)-4-(3,6-dihydro-2H-pyran-4-yl)-10-methyl-12-nitro-7-oxo-1,3,5,6-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,8-trien-8-yl]-2,5-diazabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 171513552) has the molecular formula C25H33N7O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is tert-butyl (1S,6S)-5-[(10R,12S)-4-(3,6-dihydro-2H-pyran-4-yl)-10-methyl-12-nitro-7-oxo-1,3,5,6-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,8-trien-8-yl]-2,5-diazabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | tert-butyl (1S,6S)-5-[(10R,12S)-4-(3,6-dihydro-2H-pyran-4-yl)-10-methyl-12-nitro-7-oxo-1,3,5,6-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,8-trien-8-yl]-2,5-diazabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 171513552 |
| Molecular Formula | C25H33N7O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | tert-butyl (1S,6S)-5-[(10R,12S)-4-(3,6-dihydro-2H-pyran-4-yl)-10-methyl-12-nitro-7-oxo-1,3,5,6-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,8-trien-8-yl]-2,5-diazabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C[C@@H]1C[C@H]([N+](=O)[O-])n2c1c(N1CCN(C(=O)OC(C)(C)C)[C@H]3CC[C@@H]31)c(=O)n1nc(C3=CCOCC3)nc21 |
| InChI | InChI=1S/C25H33N7O6/c1-14-13-18(32(35)36)30-19(14)20(22(33)31-23(30)26-21(27-31)15-7-11-37-12-8-15)28-9-10-29(17-6-5-16(17)28)24(34)38-25(2,3)4/h7,14,16-18H,5-6,8-13H2,1-4H3/t14-,16+,17+,18+/m1/s1 |
| InChIKey | YETRTSRZCYBZTF-UBDQQSCGSA-N |
| XLogP | 2.57 |
| TPSA | 137.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|