C16H20N2O — CID 166143798
1-[3-(6-methyl-2-pyridinyl)piperidin-1-yl]pent-2-yn-1-one (PubChem CID 166143798) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-[3-(6-methyl-2-pyridinyl)piperidin-1-yl]pent-2-yn-1-one.
| Compound Name | 1-[3-(6-methyl-2-pyridinyl)piperidin-1-yl]pent-2-yn-1-one |
|---|---|
| PubChem CID | 166143798 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-[3-(6-methyl-2-pyridinyl)piperidin-1-yl]pent-2-yn-1-one |
| SMILES | CCC#CC(=O)N1CCCC(c2cccc(C)n2)C1 |
| InChI | InChI=1S/C16H20N2O/c1-3-4-10-16(19)18-11-6-8-14(12-18)15-9-5-7-13(2)17-15/h5,7,9,14H,3,6,8,11-12H2,1-2H3 |
| InChIKey | IFJXKJJYJWYQEF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|