C54H79BFN8O4 — CID 166144085
CID 166144085 (PubChem CID 166144085) has the molecular formula C54H79BFN8O4 and a molecular weight of 934.09 g/mol.
| Compound Name | CID 166144085 |
|---|---|
| PubChem CID | 166144085 |
| Molecular Formula | C54H79BFN8O4 |
| Molecular Weight | 934.09 g/mol |
| Exact Mass | 933.63 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1C[B]C1.C=COCC(C)(C)Cc1c(-c2cccnc2C(C)OC)n(CC)c2ccc(-c3cc(CF)cc(CC(NC(=C)C(C(C)C)N(C)C=C)C(=O)CCCCNN)c3)cc12.CN |
| InChI | InChI=1S/C48H67FN6O3.C5H7BNO.CH5N/c1-12-54(10)46(32(4)5)33(6)53-42(44(56)19-15-16-23-52-50)27-35-24-36(30-49)26-38(25-35)37-20-21-43-40(28-37)41(29-48(8,9)31-58-14-3)47(55(43)13-2)39-18-17-22-51-45(39)34(7)57-11;1-2-5(8)7-3-6-4-7;1-2/h12,14,17-18,20-22,24-26,28,32,34,42,46,52-53H,1,3,6,13,15-16,19,23,27,29-31,50H2,2,4-5,7-11H3;2H,1,3-4H2;2H2,1H3 |
| InChIKey | MSCDOWQNBOVFCL-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.09 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|