C53H76BN8O5 — CID 166145529
CID 166145529 (PubChem CID 166145529) has the molecular formula C53H76BN8O5 and a molecular weight of 916.05 g/mol.
| Compound Name | CID 166145529 |
|---|---|
| PubChem CID | 166145529 |
| Molecular Formula | C53H76BN8O5 |
| Molecular Weight | 916.05 g/mol |
| Exact Mass | 915.60 |
| IUPAC Name | — |
| SMILES | C=CC(=O)N1C[B]C1.C=COCC(C)(C)Cc1c(-c2cccnc2C(C)OC)n(CC)c2ccc(-c3cccc(CC(NC(=C)C(C4COC4)N(C)C=C)C(=O)CCCCNN)c3)cc12.CN |
| InChI | InChI=1S/C47H64N6O4.C5H7BNO.CH5N/c1-10-52(8)45(37-29-57-30-37)32(4)51-41(43(54)20-13-14-24-50-48)26-34-17-15-18-35(25-34)36-21-22-42-39(27-36)40(28-47(6,7)31-56-12-3)46(53(42)11-2)38-19-16-23-49-44(38)33(5)55-9;1-2-5(8)7-3-6-4-7;1-2/h10,12,15-19,21-23,25,27,33,37,41,45,50-51H,1,3-4,11,13-14,20,24,26,28-31,48H2,2,5-9H3;2H,1,3-4H2;2H2,1H3 |
| InChIKey | BHUGECDAKJPZCQ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 162.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.05 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|