C43H55N6O6SSi2 — CID 166144917
CID 166144917 (PubChem CID 166144917) has the molecular formula C43H55N6O6SSi2 and a molecular weight of 840.19 g/mol.
| Compound Name | CID 166144917 |
|---|---|
| PubChem CID | 166144917 |
| Molecular Formula | C43H55N6O6SSi2 |
| Molecular Weight | 840.19 g/mol |
| Exact Mass | 839.34 |
| IUPAC Name | — |
| SMILES | CCn1c(-c2cccnc2[C@@](C)([Si])OC)c2c3cc(ccc31)-c1csc(n1)C[C@H](C([Si]C)C(=O)N1CC[C@H]1CCOC)C(=O)N1CCC[C@H](N1)C(=O)OCC(C)(C)C2 |
| InChI | InChI=1S/C43H55N6O6SSi2/c1-8-47-34-14-13-26-21-29(34)31(36(47)28-11-9-17-44-38(28)43(4,57)54-6)23-42(2,3)25-55-41(52)32-12-10-18-49(46-32)39(50)30(22-35-45-33(26)24-56-35)37(58-7)40(51)48-19-15-27(48)16-20-53-5/h9,11,13-14,17,21,24,27,30,32,37,46H,8,10,12,15-16,18-20,22-23,25H2,1-7H3/t27-,30+,32-,37?,43+/m0/s1 |
| InChIKey | VLIZBDMNFBFCPT-KCMJKNOKSA-N |
| XLogP | 5.79 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.19 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|