C51H65N8O6SSi2 — CID 171516728
CID 171516728 (PubChem CID 171516728) has the molecular formula C51H65N8O6SSi2 and a molecular weight of 974.37 g/mol.
| Compound Name | CID 171516728 |
|---|---|
| PubChem CID | 171516728 |
| Molecular Formula | C51H65N8O6SSi2 |
| Molecular Weight | 974.37 g/mol |
| Exact Mass | 973.43 |
| IUPAC Name | — |
| SMILES | CCn1c(-c2cccnc2[C@@](C)([Si])OC)c2c3cc(ccc31)-c1csc(n1)CC1(C(=O)N3CCC[C@H](N3)C(=O)OCC(C)(C)C2)C2[Si][C@@H]2C1C(=O)C(=C(C)C)N(C)C(=O)N1[C@H](C)CN(C)C[C@H]1C |
| InChI | InChI=1S/C51H65N8O6SSi2/c1-12-57-37-18-17-31-21-33(37)34(41(57)32-15-13-19-52-44(32)50(8,67)64-11)22-49(6,7)27-65-46(61)35-16-14-20-58(54-35)47(62)51(23-38-53-36(31)26-66-38)39(43-45(51)68-43)42(60)40(28(2)3)56(10)48(63)59-29(4)24-55(9)25-30(59)5/h13,15,17-19,21,26,29-30,35,39,43,45,54H,12,14,16,20,22-25,27H2,1-11H3/t29-,30-,35+,39?,43-,45?,50-,51?/m1/s1 |
| InChIKey | CRSVQWCKOXWQNG-DPSUERDZSA-N |
| XLogP | 6.85 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.37 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|