C49H73N8O7S2Sb — CID 166145059
CID 166145059 (PubChem CID 166145059) has the molecular formula C49H73N8O7S2Sb and a molecular weight of 1072.07 g/mol.
| Compound Name | CID 166145059 |
|---|---|
| PubChem CID | 166145059 |
| Molecular Formula | C49H73N8O7S2Sb |
| Molecular Weight | 1072.07 g/mol |
| Exact Mass | 1070.41 |
| IUPAC Name | — |
| SMILES | CC1COCCN1C=O.CCn1c(-c2cccnc2C(C)OC)c(CC(C)(C)COC=O)c2cc(-c3csc(CC(NC(=O)C(SN(C)C)C(C)C)C(=O)N4CCCCN4C)n3)ccc21.C[Sb] |
| InChI | InChI=1S/C42H59N7O5S2.C6H11NO2.CH3.Sb/c1-11-48-35-17-16-29(21-31(35)32(23-42(5,6)25-54-26-50)38(48)30-15-14-18-43-37(30)28(4)53-10)34-24-55-36(44-34)22-33(41(52)49-20-13-12-19-47(49)9)45-40(51)39(27(2)3)56-46(7)8;1-6-4-9-3-2-7(6)5-8;;/h14-18,21,24,26-28,33,39H,11-13,19-20,22-23,25H2,1-10H3,(H,45,51);5-6H,2-4H2,1H3;1H3; |
| InChIKey | HKWZRHAPPQPCCV-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 151.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1072.07 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|