C48H71N8O7S2Sb — CID 171516462
CID 171516462 (PubChem CID 171516462) has the molecular formula C48H71N8O7S2Sb and a molecular weight of 1058.04 g/mol.
| Compound Name | CID 171516462 |
|---|---|
| PubChem CID | 171516462 |
| Molecular Formula | C48H71N8O7S2Sb |
| Molecular Weight | 1058.04 g/mol |
| Exact Mass | 1056.39 |
| IUPAC Name | — |
| SMILES | CCn1c(-c2cccnc2C(C)OC)c(CC(C)(C)COC=O)c2cc(-c3csc(CC(NC(=O)C(SN(C)C=O)C(C)C)C(=O)N4CCCCN4)n3)ccc21.COC1CN(C)C1C.C[Sb] |
| InChI | InChI=1S/C41H55N7O6S2.C6H13NO.CH3.Sb/c1-9-47-34-15-14-28(19-30(34)31(21-41(5,6)23-54-25-50)37(47)29-13-12-16-42-36(29)27(4)53-8)33-22-55-35(44-33)20-32(40(52)48-18-11-10-17-43-48)45-39(51)38(26(2)3)56-46(7)24-49;1-5-6(8-3)4-7(5)2;;/h12-16,19,22,24-27,32,38,43H,9-11,17-18,20-21,23H2,1-8H3,(H,45,51);5-6H,4H2,1-3H3;1H3; |
| InChIKey | QJCUFYJABLPBEQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1058.04 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|