C25H24ClF3N4O2S2 — CID 166145772
8-(4-chlorothiophen-2-yl)-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-12-methyl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 166145772) has the molecular formula C25H24ClF3N4O2S2 and a molecular weight of 569.07 g/mol. Its IUPAC name is 8-(4-chlorothiophen-2-yl)-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-12-methyl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 8-(4-chlorothiophen-2-yl)-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-12-methyl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 166145772 |
| Molecular Formula | C25H24ClF3N4O2S2 |
| Molecular Weight | 569.07 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 8-(4-chlorothiophen-2-yl)-4-[(3S,5R)-3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-12-methyl-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | C=CC(=O)N1[C@H](C)CN(c2nc(=O)n3c4c(c(-c5cc(Cl)cs5)c(C(F)(F)F)cc24)SCC3C)C[C@@H]1C |
| InChI | InChI=1S/C25H24ClF3N4O2S2/c1-5-19(34)32-12(2)8-31(9-13(32)3)23-16-7-17(25(27,28)29)20(18-6-15(26)11-36-18)22-21(16)33(24(35)30-23)14(4)10-37-22/h5-7,11-14H,1,8-10H2,2-4H3/t12-,13+,14? |
| InChIKey | ISOJBJUTZYICLW-PBWFPOADSA-N |
| XLogP | 6.08 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.07 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|