C30H27ClF3N5O3S2 — CID 166145781
8-(4-chlorothiophen-2-yl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14),12-pentaen-2-one;1H-pyridin-2-one (PubChem CID 166145781) has the molecular formula C30H27ClF3N5O3S2 and a molecular weight of 662.16 g/mol. Its IUPAC name is 8-(4-chlorothiophen-2-yl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14),12-pentaen-2-one;1H-pyridin-2-one.
| Compound Name | 8-(4-chlorothiophen-2-yl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14),12-pentaen-2-one;1H-pyridin-2-one |
|---|---|
| PubChem CID | 166145781 |
| Molecular Formula | C30H27ClF3N5O3S2 |
| Molecular Weight | 662.16 g/mol |
| Exact Mass | 661.12 |
| IUPAC Name | 8-(4-chlorothiophen-2-yl)-4-(3,5-dimethyl-4-prop-2-enoylpiperazin-1-yl)-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14),12-pentaen-2-one;1H-pyridin-2-one |
| SMILES | C=CC(=O)N1C(C)CN(c2nc(=O)n3c4c(c(-c5cc(Cl)cs5)c(C(F)(F)F)cc24)SCC=C3)CC1C.O=c1cccc[nH]1 |
| InChI | InChI=1S/C25H22ClF3N4O2S2.C5H5NO/c1-4-19(34)33-13(2)10-31(11-14(33)3)23-16-9-17(25(27,28)29)20(18-8-15(26)12-37-18)22-21(16)32(24(35)30-23)6-5-7-36-22;7-5-3-1-2-4-6-5/h4-6,8-9,12-14H,1,7,10-11H2,2-3H3;1-4H,(H,6,7) |
| InChIKey | KVLPAPQRNNPBNA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.16 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|