C19H17BrN2O4 — CID 166146808
methyl 3-[[(1R)-1-(2-bromo-6-methyl-4-oxochromen-8-yl)ethyl]amino]pyridine-2-carboxylate (PubChem CID 166146808) has the molecular formula C19H17BrN2O4 and a molecular weight of 417.26 g/mol. Its IUPAC name is methyl 3-[[(1R)-1-(2-bromo-6-methyl-4-oxochromen-8-yl)ethyl]amino]pyridine-2-carboxylate.
| Compound Name | methyl 3-[[(1R)-1-(2-bromo-6-methyl-4-oxochromen-8-yl)ethyl]amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 166146808 |
| Molecular Formula | C19H17BrN2O4 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | methyl 3-[[(1R)-1-(2-bromo-6-methyl-4-oxochromen-8-yl)ethyl]amino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncccc1N[C@H](C)c1cc(C)cc2c(=O)cc(Br)oc12 |
| InChI | InChI=1S/C19H17BrN2O4/c1-10-7-12(18-13(8-10)15(23)9-16(20)26-18)11(2)22-14-5-4-6-21-17(14)19(24)25-3/h4-9,11,22H,1-3H3/t11-/m1/s1 |
| InChIKey | NSCRTSXTPALMMG-LLVKDONJSA-N |
| XLogP | 4.22 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |