C27H22ClN3O3 — CID 177366659
methyl 6-chloro-3-[1-(8-methyl-4-phenyl-[1]benzofuro[3,2-b]pyridin-6-yl)ethylamino]pyridine-2-carboxylate (PubChem CID 177366659) has the molecular formula C27H22ClN3O3 and a molecular weight of 471.94 g/mol. Its IUPAC name is methyl 6-chloro-3-[1-(8-methyl-4-phenyl-[1]benzofuro[3,2-b]pyridin-6-yl)ethylamino]pyridine-2-carboxylate.
| Compound Name | methyl 6-chloro-3-[1-(8-methyl-4-phenyl-[1]benzofuro[3,2-b]pyridin-6-yl)ethylamino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 177366659 |
| Molecular Formula | C27H22ClN3O3 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | methyl 6-chloro-3-[1-(8-methyl-4-phenyl-[1]benzofuro[3,2-b]pyridin-6-yl)ethylamino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)ccc1NC(C)c1cc(C)cc2c1oc1c(-c3ccccc3)ccnc12 |
| InChI | InChI=1S/C27H22ClN3O3/c1-15-13-19(16(2)30-21-9-10-22(28)31-24(21)27(32)33-3)25-20(14-15)23-26(34-25)18(11-12-29-23)17-7-5-4-6-8-17/h4-14,16,30H,1-3H3 |
| InChIKey | PUUJOCARTDPFHU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|