C16H24O5 — CID 166149764
(1R,4S,5R,8S,9R)-1,5,8,9-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 166149764) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is (1R,4S,5R,8S,9R)-1,5,8,9-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,9R)-1,5,8,9-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 166149764 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (1R,4S,5R,8S,9R)-1,5,8,9-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@@]2(C)[C@@H](C)C(=O)OC3O[C@@]4(C)CC[C@@H]1C32OO4 |
| InChI | InChI=1S/C16H24O5/c1-9-5-7-14(3)10(2)12(17)18-13-16(14)11(9)6-8-15(4,19-13)20-21-16/h9-11,13H,5-8H2,1-4H3/t9-,10+,11+,13?,14+,15-,16?/m1/s1 |
| InChIKey | PQLXQSQKSNHNFX-VHGLTVSZSA-N |
| XLogP | 2.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|