C23H34O6 — CID 71816472
2-[(1S)-1-hydroxy-2-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,8,9-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl]cyclopent-2-en-1-one (PubChem CID 71816472) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-[(1S)-1-hydroxy-2-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,8,9-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl]cyclopent-2-en-1-one.
| Compound Name | 2-[(1S)-1-hydroxy-2-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,8,9-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 71816472 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-[(1S)-1-hydroxy-2-[(1S,4S,5R,8S,9R,10R,12R,13R)-1,5,8,9-tetramethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl]cyclopent-2-en-1-one |
| SMILES | C[C@@H]1CC[C@@]2(C)[C@@H](C)[C@@H](C[C@H](O)C3=CCCC3=O)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C23H34O6/c1-13-8-10-21(3)14(2)19(12-18(25)15-6-5-7-17(15)24)26-20-23(21)16(13)9-11-22(4,27-20)28-29-23/h6,13-14,16,18-20,25H,5,7-12H2,1-4H3/t13-,14+,16+,18+,19-,20-,21+,22+,23+/m1/s1 |
| InChIKey | AMZUCWSEARTGCD-FXRUHXRGSA-N |
| XLogP | 3.67 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|