C36H56O10S — CID 86294850
[(1S)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl] propan-2-ylsulfanylformate (PubChem CID 86294850) has the molecular formula C36H56O10S and a molecular weight of 680.90 g/mol. Its IUPAC name is [(1S)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl] propan-2-ylsulfanylformate.
| Compound Name | [(1S)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl] propan-2-ylsulfanylformate |
|---|---|
| PubChem CID | 86294850 |
| Molecular Formula | C36H56O10S |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | [(1S)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl] propan-2-ylsulfanylformate |
| SMILES | CC(C)SC(=O)O[C@@H](C[C@H]1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)[C@H]1O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3 |
| InChI | InChI=1S/C36H56O10S/c1-18(2)47-32(37)39-28(29-22(6)26-12-10-20(4)24-14-16-34(8)42-31(40-29)36(24,26)46-44-34)17-27-21(5)25-11-9-19(3)23-13-15-33(7)41-30(38-27)35(23,25)45-43-33/h18-31H,9-17H2,1-8H3/t19-,20-,21-,22-,23+,24+,25+,26+,27-,28+,29+,30-,31-,33+,34+,35-,36-/m1/s1 |
| InChIKey | GNRMIWDDFMFCBK-UNEYMVBJSA-N |
| XLogP | 7.52 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|