C39H53ClO11 — CID 86294844
[(1S)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl] (4-chlorophenyl) carbonate (PubChem CID 86294844) has the molecular formula C39H53ClO11 and a molecular weight of 733.29 g/mol. Its IUPAC name is [(1S)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl] (4-chlorophenyl) carbonate.
| Compound Name | [(1S)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl] (4-chlorophenyl) carbonate |
|---|---|
| PubChem CID | 86294844 |
| Molecular Formula | C39H53ClO11 |
| Molecular Weight | 733.29 g/mol |
| Exact Mass | 732.33 |
| IUPAC Name | [(1S)-1,2-bis[(1S,4S,5R,8S,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl] (4-chlorophenyl) carbonate |
| SMILES | C[C@H]1[C@@H]([C@H](C[C@H]2O[C@@H]3O[C@]4(C)CC[C@H]5[C@H](C)CC[C@@H]([C@H]2C)[C@@]35OO4)OC(=O)Oc2ccc(Cl)cc2)O[C@@H]2O[C@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C39H53ClO11/c1-20-7-13-28-22(3)30(43-33-38(28)26(20)15-17-36(5,46-33)48-50-38)19-31(44-35(41)42-25-11-9-24(40)10-12-25)32-23(4)29-14-8-21(2)27-16-18-37(6)47-34(45-32)39(27,29)51-49-37/h9-12,20-23,26-34H,7-8,13-19H2,1-6H3/t20-,21-,22-,23-,26+,27+,28+,29+,30-,31+,32+,33-,34-,36+,37+,38-,39-/m1/s1 |
| InChIKey | WHMGEZBGBXJLIZ-YFKWNTITSA-N |
| XLogP | 8.12 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.29 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|