C13H24N2O3S — CID 166152295
tert-butyl 3-(2-methylsulfanyloxyethyl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (PubChem CID 166152295) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is tert-butyl 3-(2-methylsulfanyloxyethyl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate.
| Compound Name | tert-butyl 3-(2-methylsulfanyloxyethyl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
|---|---|
| PubChem CID | 166152295 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl 3-(2-methylsulfanyloxyethyl)-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
| SMILES | CSOCCN1CC2CC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H24N2O3S/c1-13(2,3)18-12(16)15-10-7-11(15)9-14(8-10)5-6-17-19-4/h10-11H,5-9H2,1-4H3 |
| InChIKey | LHVINPZOGOORCG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|