C21H27F4N5O2 — CID 166152968
6-[2-(ethoxymethoxy)-6-fluoro-4-(trifluoromethyl)phenyl]-N-[(3R)-1-ethylpiperidin-3-yl]-5-methyl-1,2,4-triazin-3-amine (PubChem CID 166152968) has the molecular formula C21H27F4N5O2 and a molecular weight of 457.47 g/mol. Its IUPAC name is 6-[2-(ethoxymethoxy)-6-fluoro-4-(trifluoromethyl)phenyl]-N-[(3R)-1-ethylpiperidin-3-yl]-5-methyl-1,2,4-triazin-3-amine.
| Compound Name | 6-[2-(ethoxymethoxy)-6-fluoro-4-(trifluoromethyl)phenyl]-N-[(3R)-1-ethylpiperidin-3-yl]-5-methyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 166152968 |
| Molecular Formula | C21H27F4N5O2 |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 6-[2-(ethoxymethoxy)-6-fluoro-4-(trifluoromethyl)phenyl]-N-[(3R)-1-ethylpiperidin-3-yl]-5-methyl-1,2,4-triazin-3-amine |
| SMILES | CCOCOc1cc(C(F)(F)F)cc(F)c1-c1nnc(N[C@@H]2CCCN(CC)C2)nc1C |
| InChI | InChI=1S/C21H27F4N5O2/c1-4-30-8-6-7-15(11-30)27-20-26-13(3)19(28-29-20)18-16(22)9-14(21(23,24)25)10-17(18)32-12-31-5-2/h9-10,15H,4-8,11-12H2,1-3H3,(H,26,27,29)/t15-/m1/s1 |
| InChIKey | UFETUDUSVWKTAB-OAHLLOKOSA-N |
| XLogP | 4.27 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|