C18H13F2N3O2S — CID 166153238
4-benzyl-N-(4-cyano-2-fluorophenyl)-5-fluoro-1H-pyrrole-3-sulfonamide (PubChem CID 166153238) has the molecular formula C18H13F2N3O2S and a molecular weight of 373.38 g/mol. Its IUPAC name is 4-benzyl-N-(4-cyano-2-fluorophenyl)-5-fluoro-1H-pyrrole-3-sulfonamide.
| Compound Name | 4-benzyl-N-(4-cyano-2-fluorophenyl)-5-fluoro-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 166153238 |
| Molecular Formula | C18H13F2N3O2S |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-benzyl-N-(4-cyano-2-fluorophenyl)-5-fluoro-1H-pyrrole-3-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2c[nH]c(F)c2Cc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C18H13F2N3O2S/c19-15-9-13(10-21)6-7-16(15)23-26(24,25)17-11-22-18(20)14(17)8-12-4-2-1-3-5-12/h1-7,9,11,22-23H,8H2 |
| InChIKey | TXIDLDZLWCONNY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |