C17H11F2N3O2S — CID 166153747
N-(4-cyano-2-fluorophenyl)-4-(4-fluorophenyl)-1H-pyrrole-3-sulfonamide (PubChem CID 166153747) has the molecular formula C17H11F2N3O2S and a molecular weight of 359.36 g/mol. Its IUPAC name is N-(4-cyano-2-fluorophenyl)-4-(4-fluorophenyl)-1H-pyrrole-3-sulfonamide.
| Compound Name | N-(4-cyano-2-fluorophenyl)-4-(4-fluorophenyl)-1H-pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 166153747 |
| Molecular Formula | C17H11F2N3O2S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | N-(4-cyano-2-fluorophenyl)-4-(4-fluorophenyl)-1H-pyrrole-3-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2c[nH]cc2-c2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C17H11F2N3O2S/c18-13-4-2-12(3-5-13)14-9-21-10-17(14)25(23,24)22-16-6-1-11(8-20)7-15(16)19/h1-7,9-10,21-22H |
| InChIKey | ZOSNQUMNPROARL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |