C23H17F2N3O3 — CID 166155644
N-[4-[1-(difluoromethyl)benzimidazol-2-yl]phenyl]-3-(2-oxoethoxy)benzamide (PubChem CID 166155644) has the molecular formula C23H17F2N3O3 and a molecular weight of 421.40 g/mol. Its IUPAC name is N-[4-[1-(difluoromethyl)benzimidazol-2-yl]phenyl]-3-(2-oxoethoxy)benzamide.
| Compound Name | N-[4-[1-(difluoromethyl)benzimidazol-2-yl]phenyl]-3-(2-oxoethoxy)benzamide |
|---|---|
| PubChem CID | 166155644 |
| Molecular Formula | C23H17F2N3O3 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[4-[1-(difluoromethyl)benzimidazol-2-yl]phenyl]-3-(2-oxoethoxy)benzamide |
| SMILES | O=CCOc1cccc(C(=O)Nc2ccc(-c3nc4ccccc4n3C(F)F)cc2)c1 |
| InChI | InChI=1S/C23H17F2N3O3/c24-23(25)28-20-7-2-1-6-19(20)27-21(28)15-8-10-17(11-9-15)26-22(30)16-4-3-5-18(14-16)31-13-12-29/h1-12,14,23H,13H2,(H,26,30) |
| InChIKey | JEEJWQVECNVBJB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|