C27H39F3N4O5 — CID 166157081
(2S,4S)-1-[2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide (PubChem CID 166157081) has the molecular formula C27H39F3N4O5 and a molecular weight of 556.63 g/mol. Its IUPAC name is (2S,4S)-1-[2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166157081 |
| Molecular Formula | C27H39F3N4O5 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | (2S,4S)-1-[2-cyclohexyl-2-[(2,2,2-trifluoroacetyl)amino]acetyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H]1N(C(=O)C(NC(=O)C(F)(F)F)C2CCCCC2)C[C@@H](C)C1(C)C |
| InChI | InChI=1S/C27H39F3N4O5/c1-5-19(35)18(13-17-11-12-31-22(17)36)32-23(37)21-26(3,4)15(2)14-34(21)24(38)20(16-9-7-6-8-10-16)33-25(39)27(28,29)30/h5,15-18,20-21H,1,6-14H2,2-4H3,(H,31,36)(H,32,37)(H,33,39)/t15-,17+,18+,20?,21-/m1/s1 |
| InChIKey | OCOWPNQMKFTEQC-ZVDCKZPBSA-N |
| XLogP | 2.25 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|