C28H32N2O5S — CID 166158267
4-[(2R,4R)-4-(cyclopropylmethoxy)-1-(4-methyl-6,6-dioxo-3,7,8,9-tetrahydrothiopyrano[3,2-e]indol-9-yl)piperidin-2-yl]benzoic acid (PubChem CID 166158267) has the molecular formula C28H32N2O5S and a molecular weight of 508.64 g/mol. Its IUPAC name is 4-[(2R,4R)-4-(cyclopropylmethoxy)-1-(4-methyl-6,6-dioxo-3,7,8,9-tetrahydrothiopyrano[3,2-e]indol-9-yl)piperidin-2-yl]benzoic acid.
| Compound Name | 4-[(2R,4R)-4-(cyclopropylmethoxy)-1-(4-methyl-6,6-dioxo-3,7,8,9-tetrahydrothiopyrano[3,2-e]indol-9-yl)piperidin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 166158267 |
| Molecular Formula | C28H32N2O5S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 4-[(2R,4R)-4-(cyclopropylmethoxy)-1-(4-methyl-6,6-dioxo-3,7,8,9-tetrahydrothiopyrano[3,2-e]indol-9-yl)piperidin-2-yl]benzoic acid |
| SMILES | Cc1cc2c(c3cc[nH]c13)C(N1CC[C@@H](OCC3CC3)C[C@@H]1c1ccc(C(=O)O)cc1)CCS2(=O)=O |
| InChI | InChI=1S/C28H32N2O5S/c1-17-14-25-26(22-8-11-29-27(17)22)23(10-13-36(25,33)34)30-12-9-21(35-16-18-2-3-18)15-24(30)19-4-6-20(7-5-19)28(31)32/h4-8,11,14,18,21,23-24,29H,2-3,9-10,12-13,15-16H2,1H3,(H,31,32)/t21-,23?,24-/m1/s1 |
| InChIKey | KIGAVZVDNAAVRH-VNDUYKDKSA-N |
| XLogP | 5.03 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |