C10H22N4 — CID 166160047
methane;(E)-3-(1-methylpiperidin-4-yl)iminoprop-1-ene-1,2-diamine (PubChem CID 166160047) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is methane;(E)-3-(1-methylpiperidin-4-yl)iminoprop-1-ene-1,2-diamine.
| Compound Name | methane;(E)-3-(1-methylpiperidin-4-yl)iminoprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 166160047 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | methane;(E)-3-(1-methylpiperidin-4-yl)iminoprop-1-ene-1,2-diamine |
| SMILES | C.CN1CCC(/N=C/C(N)=C\N)CC1 |
| InChI | InChI=1S/C9H18N4.CH4/c1-13-4-2-9(3-5-13)12-7-8(11)6-10;/h6-7,9H,2-5,10-11H2,1H3;1H4/b8-6+,12-7+; |
| InChIKey | DYHYNJSXCCIYQI-FSNKCASMSA-N |
| XLogP | 0.55 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|