C23H26N6O — CID 166161453
N-[(E)-[2-amino-1-[5-(5-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl)-2-methylphenyl]ethylidene]amino]formamide (PubChem CID 166161453) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[(E)-[2-amino-1-[5-(5-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl)-2-methylphenyl]ethylidene]amino]formamide.
| Compound Name | N-[(E)-[2-amino-1-[5-(5-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl)-2-methylphenyl]ethylidene]amino]formamide |
|---|---|
| PubChem CID | 166161453 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N-[(E)-[2-amino-1-[5-(5-benzyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl)-2-methylphenyl]ethylidene]amino]formamide |
| SMILES | Cc1ccc(-c2cnn3c2CN(Cc2ccccc2)CC3)cc1/C(CN)=N\NC=O |
| InChI | InChI=1S/C23H26N6O/c1-17-7-8-19(11-20(17)22(12-24)27-25-16-30)21-13-26-29-10-9-28(15-23(21)29)14-18-5-3-2-4-6-18/h2-8,11,13,16H,9-10,12,14-15,24H2,1H3,(H,25,30)/b27-22- |
| InChIKey | CPPDEWYNSHYOHR-QYQHSDTDSA-N |
| XLogP | 2.28 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|