C20H15ClFN5O2 — CID 166161854
5-chloro-1-[[2-(3-fluoro-5-methoxyphenyl)pyrimidin-5-yl]methyl]indazole-7-carboxamide (PubChem CID 166161854) has the molecular formula C20H15ClFN5O2 and a molecular weight of 411.82 g/mol. Its IUPAC name is 5-chloro-1-[[2-(3-fluoro-5-methoxyphenyl)pyrimidin-5-yl]methyl]indazole-7-carboxamide.
| Compound Name | 5-chloro-1-[[2-(3-fluoro-5-methoxyphenyl)pyrimidin-5-yl]methyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 166161854 |
| Molecular Formula | C20H15ClFN5O2 |
| Molecular Weight | 411.82 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 5-chloro-1-[[2-(3-fluoro-5-methoxyphenyl)pyrimidin-5-yl]methyl]indazole-7-carboxamide |
| SMILES | COc1cc(F)cc(-c2ncc(Cn3ncc4cc(Cl)cc(C(N)=O)c43)cn2)c1 |
| InChI | InChI=1S/C20H15ClFN5O2/c1-29-16-4-12(3-15(22)6-16)20-24-7-11(8-25-20)10-27-18-13(9-26-27)2-14(21)5-17(18)19(23)28/h2-9H,10H2,1H3,(H2,23,28) |
| InChIKey | SYANLFRVWPAPLW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |