C21H21BrClN3O — CID 170309451
1-[(4-bromophenyl)methyl]-5-chloro-N-cyclohexylindazole-7-carboxamide (PubChem CID 170309451) has the molecular formula C21H21BrClN3O and a molecular weight of 446.78 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-5-chloro-N-cyclohexylindazole-7-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-5-chloro-N-cyclohexylindazole-7-carboxamide |
|---|---|
| PubChem CID | 170309451 |
| Molecular Formula | C21H21BrClN3O |
| Molecular Weight | 446.78 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-5-chloro-N-cyclohexylindazole-7-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cc(Cl)cc2cnn(Cc3ccc(Br)cc3)c12 |
| InChI | InChI=1S/C21H21BrClN3O/c22-16-8-6-14(7-9-16)13-26-20-15(12-24-26)10-17(23)11-19(20)21(27)25-18-4-2-1-3-5-18/h6-12,18H,1-5,13H2,(H,25,27) |
| InChIKey | FNCVSWTWZSZWMT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.78 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |