C20H16F2N2O3 — CID 166161887
1-[1-[4-(difluoromethoxy)phenyl]ethyl]-4-prop-1-ynylindazole-7-carboxylic acid (PubChem CID 166161887) has the molecular formula C20H16F2N2O3 and a molecular weight of 370.36 g/mol. Its IUPAC name is 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-4-prop-1-ynylindazole-7-carboxylic acid.
| Compound Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-4-prop-1-ynylindazole-7-carboxylic acid |
|---|---|
| PubChem CID | 166161887 |
| Molecular Formula | C20H16F2N2O3 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[1-[4-(difluoromethoxy)phenyl]ethyl]-4-prop-1-ynylindazole-7-carboxylic acid |
| SMILES | CC#Cc1ccc(C(=O)O)c2c1cnn2C(C)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H16F2N2O3/c1-3-4-14-7-10-16(19(25)26)18-17(14)11-23-24(18)12(2)13-5-8-15(9-6-13)27-20(21)22/h5-12,20H,1-2H3,(H,25,26) |
| InChIKey | CBMZVGPPPSYNBX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|