C13H30N2O — CID 166168806
N-ethyl-N,N'-dimethyl-N'-[3-(2-methylpropoxy)propyl]ethane-1,2-diamine (PubChem CID 166168806) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is N-ethyl-N,N'-dimethyl-N'-[3-(2-methylpropoxy)propyl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N,N'-dimethyl-N'-[3-(2-methylpropoxy)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 166168806 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | N-ethyl-N,N'-dimethyl-N'-[3-(2-methylpropoxy)propyl]ethane-1,2-diamine |
| SMILES | CCN(C)CCN(C)CCCOCC(C)C |
| InChI | InChI=1S/C13H30N2O/c1-6-14(4)9-10-15(5)8-7-11-16-12-13(2)3/h13H,6-12H2,1-5H3 |
| InChIKey | QIXPASBODLDRPD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|