C30H33FN2O2 — CID 166168844
N-[(3E)-3-fluoro-6-methyl-5-methylidenenona-1,3-dien-2-yl]-2,6-bis(phenylmethoxy)pyridin-3-amine (PubChem CID 166168844) has the molecular formula C30H33FN2O2 and a molecular weight of 472.60 g/mol. Its IUPAC name is N-[(3E)-3-fluoro-6-methyl-5-methylidenenona-1,3-dien-2-yl]-2,6-bis(phenylmethoxy)pyridin-3-amine.
| Compound Name | N-[(3E)-3-fluoro-6-methyl-5-methylidenenona-1,3-dien-2-yl]-2,6-bis(phenylmethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 166168844 |
| Molecular Formula | C30H33FN2O2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-[(3E)-3-fluoro-6-methyl-5-methylidenenona-1,3-dien-2-yl]-2,6-bis(phenylmethoxy)pyridin-3-amine |
| SMILES | C=C(Nc1ccc(OCc2ccccc2)nc1OCc1ccccc1)/C(F)=C\C(=C)C(C)CCC |
| InChI | InChI=1S/C30H33FN2O2/c1-5-12-22(2)23(3)19-27(31)24(4)32-28-17-18-29(34-20-25-13-8-6-9-14-25)33-30(28)35-21-26-15-10-7-11-16-26/h6-11,13-19,22,32H,3-5,12,20-21H2,1-2H3/b27-19+ |
| InChIKey | HQWRQUQJAGGZQS-ZXVVBBHZSA-N |
| XLogP | 8.01 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|