C31H36FN7O9S — CID 166168905
tert-butyl (3R)-3-[6-[2-cyano-3-[[ethyl(methyl)sulfamoyl]amino]-6-fluorophenoxy]-5-nitro-4-oxoquinazolin-3-yl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 166168905) has the molecular formula C31H36FN7O9S and a molecular weight of 701.73 g/mol. Its IUPAC name is tert-butyl (3R)-3-[6-[2-cyano-3-[[ethyl(methyl)sulfamoyl]amino]-6-fluorophenoxy]-5-nitro-4-oxoquinazolin-3-yl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl (3R)-3-[6-[2-cyano-3-[[ethyl(methyl)sulfamoyl]amino]-6-fluorophenoxy]-5-nitro-4-oxoquinazolin-3-yl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 166168905 |
| Molecular Formula | C31H36FN7O9S |
| Molecular Weight | 701.73 g/mol |
| Exact Mass | 701.23 |
| IUPAC Name | tert-butyl (3R)-3-[6-[2-cyano-3-[[ethyl(methyl)sulfamoyl]amino]-6-fluorophenoxy]-5-nitro-4-oxoquinazolin-3-yl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CCN(C)S(=O)(=O)Nc1ccc(F)c(Oc2ccc3ncn([C@H]4COC5(CCN(C(=O)OC(C)(C)C)CC5)C4)c(=O)c3c2[N+](=O)[O-])c1C#N |
| InChI | InChI=1S/C31H36FN7O9S/c1-6-36(5)49(44,45)35-22-8-7-21(32)27(20(22)16-33)47-24-10-9-23-25(26(24)39(42)43)28(40)38(18-34-23)19-15-31(46-17-19)11-13-37(14-12-31)29(41)48-30(2,3)4/h7-10,18-19,35H,6,11-15,17H2,1-5H3/t19-/m1/s1 |
| InChIKey | KMILFONRQITMLA-LJQANCHMSA-N |
| XLogP | 4.45 |
| TPSA | 199.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.73 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|