C31H33FN10O8S — CID 166169105
tert-butyl 4-[5-[6-[2-cyano-3-[[ethyl(methyl)sulfamoyl]amino]-6-fluorophenoxy]-5-nitro-4-oxoquinazolin-3-yl]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 166169105) has the molecular formula C31H33FN10O8S and a molecular weight of 724.73 g/mol. Its IUPAC name is tert-butyl 4-[5-[6-[2-cyano-3-[[ethyl(methyl)sulfamoyl]amino]-6-fluorophenoxy]-5-nitro-4-oxoquinazolin-3-yl]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[6-[2-cyano-3-[[ethyl(methyl)sulfamoyl]amino]-6-fluorophenoxy]-5-nitro-4-oxoquinazolin-3-yl]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166169105 |
| Molecular Formula | C31H33FN10O8S |
| Molecular Weight | 724.73 g/mol |
| Exact Mass | 724.22 |
| IUPAC Name | tert-butyl 4-[5-[6-[2-cyano-3-[[ethyl(methyl)sulfamoyl]amino]-6-fluorophenoxy]-5-nitro-4-oxoquinazolin-3-yl]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CCN(C)S(=O)(=O)Nc1ccc(F)c(Oc2ccc3ncn(-c4cnc(N5CCN(C(=O)OC(C)(C)C)CC5)nc4)c(=O)c3c2[N+](=O)[O-])c1C#N |
| InChI | InChI=1S/C31H33FN10O8S/c1-6-38(5)51(47,48)37-22-8-7-21(32)27(20(22)15-33)49-24-10-9-23-25(26(24)42(45)46)28(43)41(18-36-23)19-16-34-29(35-17-19)39-11-13-40(14-12-39)30(44)50-31(2,3)4/h7-10,16-18,37H,6,11-14H2,1-5H3 |
| InChIKey | MBXCBGAIHMSGQB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 219.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|