C23H20N4O4S2 — CID 166172326
N-[(2S)-4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]-2,3-dioxo-1H-indole-5-carboxamide (PubChem CID 166172326) has the molecular formula C23H20N4O4S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is N-[(2S)-4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]-2,3-dioxo-1H-indole-5-carboxamide.
| Compound Name | N-[(2S)-4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]-2,3-dioxo-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 166172326 |
| Molecular Formula | C23H20N4O4S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N-[(2S)-4-methylsulfanyl-1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]butan-2-yl]-2,3-dioxo-1H-indole-5-carboxamide |
| SMILES | CSCC[C@H](NC(=O)c1ccc2c(c1)C(=O)C(=O)N2)C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C23H20N4O4S2/c1-32-10-9-17(21(30)27-23-26-18(12-33-23)13-5-3-2-4-6-13)25-20(29)14-7-8-16-15(11-14)19(28)22(31)24-16/h2-8,11-12,17H,9-10H2,1H3,(H,25,29)(H,24,28,31)(H,26,27,30)/t17-/m0/s1 |
| InChIKey | LOGDHIITDGLOJT-KRWDZBQOSA-N |
| XLogP | 3.44 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|