C10H15N3O2 — CID 166175013
5-methyl-1-piperidin-1-ylpyrimidine-2,4-dione (PubChem CID 166175013) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-methyl-1-piperidin-1-ylpyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-piperidin-1-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 166175013 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 5-methyl-1-piperidin-1-ylpyrimidine-2,4-dione |
| SMILES | Cc1cn(N2CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O2/c1-8-7-13(10(15)11-9(8)14)12-5-3-2-4-6-12/h7H,2-6H2,1H3,(H,11,14,15) |
| InChIKey | XEJFDVJTXGFTOR-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |