C10H12N4O2 — CID 2763482
2,4-dioxo-1-piperidin-1-ylpyrimidine-5-carbonitrile (PubChem CID 2763482) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2,4-dioxo-1-piperidin-1-ylpyrimidine-5-carbonitrile.
| Compound Name | 2,4-dioxo-1-piperidin-1-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 2763482 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2,4-dioxo-1-piperidin-1-ylpyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(N2CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12N4O2/c11-6-8-7-14(10(16)12-9(8)15)13-4-2-1-3-5-13/h7H,1-5H2,(H,12,15,16) |
| InChIKey | MINGVSNUGMBYHH-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |