C10H13N5O2 — CID 83024058
1-(4-methylpiperazin-1-yl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 83024058) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2,4-dioxopyrimidine-5-carbonitrile.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2,4-dioxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 83024058 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CN1CCN(n2cc(C#N)c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C10H13N5O2/c1-13-2-4-14(5-3-13)15-7-8(6-11)9(16)12-10(15)17/h7H,2-5H2,1H3,(H,12,16,17) |
| InChIKey | BXWXWCRUGFAJTK-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |