C29H27FN2O4S — CID 166175360
ethyl (E)-3-[3-[1-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]ethenyl]-1-methylindol-2-yl]prop-2-enoate (PubChem CID 166175360) has the molecular formula C29H27FN2O4S and a molecular weight of 518.61 g/mol. Its IUPAC name is ethyl (E)-3-[3-[1-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]ethenyl]-1-methylindol-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[3-[1-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]ethenyl]-1-methylindol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 166175360 |
| Molecular Formula | C29H27FN2O4S |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | ethyl (E)-3-[3-[1-(3-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]ethenyl]-1-methylindol-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(C(=CNS(=O)(=O)c2ccc(C)cc2)c2cccc(F)c2)c2ccccc2n1C |
| InChI | InChI=1S/C29H27FN2O4S/c1-4-36-28(33)17-16-27-29(24-10-5-6-11-26(24)32(27)3)25(21-8-7-9-22(30)18-21)19-31-37(34,35)23-14-12-20(2)13-15-23/h5-19,31H,4H2,1-3H3/b17-16+,25-19? |
| InChIKey | DRNSSTCLTNSMHA-JOCVSZQYSA-N |
| XLogP | 5.57 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|