C14H12F3N5O — CID 166175843
4-(aminomethyl)-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-4H-phthalazin-1-one (PubChem CID 166175843) has the molecular formula C14H12F3N5O and a molecular weight of 323.28 g/mol. Its IUPAC name is 4-(aminomethyl)-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-4H-phthalazin-1-one.
| Compound Name | 4-(aminomethyl)-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-4H-phthalazin-1-one |
|---|---|
| PubChem CID | 166175843 |
| Molecular Formula | C14H12F3N5O |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-(aminomethyl)-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-4H-phthalazin-1-one |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1ccc2c(c1)C(CN)N=NC2=O |
| InChI | InChI=1S/C14H12F3N5O/c1-22-11(5-12(21-22)14(15,16)17)7-2-3-8-9(4-7)10(6-18)19-20-13(8)23/h2-5,10H,6,18H2,1H3 |
| InChIKey | GOQATGHJPIHLSR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |