C20H23N9O12P2 — CID 166177498
9-[(1R,6R,8R,9R,10S,15S,17R)-8-(6-aminopurin-9-yl)-3,9,12-trihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-5H-purin-6-one (PubChem CID 166177498) has the molecular formula C20H23N9O12P2 and a molecular weight of 643.40 g/mol. Its IUPAC name is 9-[(1R,6R,8R,9R,10S,15S,17R)-8-(6-aminopurin-9-yl)-3,9,12-trihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-5H-purin-6-one.
| Compound Name | 9-[(1R,6R,8R,9R,10S,15S,17R)-8-(6-aminopurin-9-yl)-3,9,12-trihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-5H-purin-6-one |
|---|---|
| PubChem CID | 166177498 |
| Molecular Formula | C20H23N9O12P2 |
| Molecular Weight | 643.40 g/mol |
| Exact Mass | 643.09 |
| IUPAC Name | 9-[(1R,6R,8R,9R,10S,15S,17R)-8-(6-aminopurin-9-yl)-3,9,12-trihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-5H-purin-6-one |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)O[C@@H]3C[C@@H](COP(=O)(O)O[C@H]2[C@H]1O)O[C@H]3N1C=NC2C(=O)N=CN=C21 |
| InChI | InChI=1S/C20H23N9O12P2/c21-15-11-16(23-4-22-15)29(6-26-11)20-13(30)14-10(39-20)3-37-42(32,33)40-9-1-8(2-36-43(34,35)41-14)38-19(9)28-7-27-12-17(28)24-5-25-18(12)31/h4-10,12-14,19-20,30H,1-3H2,(H,32,33)(H,34,35)(H2,21,22,23)/t8-,9+,10+,12?,13+,14+,19+,20+/m0/s1 |
| InChIKey | USCALQANSZXCIX-WBBCAWBPSA-N |
| XLogP | -1.52 |
| TPSA | 277.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.40 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|