C11H15NO3 — CID 166178290
3-(3,6-dihydro-2H-pyridine-1-carbonyl)cyclobutane-1-carboxylic acid (PubChem CID 166178290) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyridine-1-carbonyl)cyclobutane-1-carboxylic acid.
| Compound Name | 3-(3,6-dihydro-2H-pyridine-1-carbonyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 166178290 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyridine-1-carbonyl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(C(=O)N2CC=CCC2)C1 |
| InChI | InChI=1S/C11H15NO3/c13-10(12-4-2-1-3-5-12)8-6-9(7-8)11(14)15/h1-2,8-9H,3-7H2,(H,14,15) |
| InChIKey | DYCUBWVKXNQNGY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|