C12H17NO3 — CID 103551261
3-(3,6-dihydro-2H-pyridine-1-carbonyl)cyclopentane-1-carboxylic acid (PubChem CID 103551261) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyridine-1-carbonyl)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(3,6-dihydro-2H-pyridine-1-carbonyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103551261 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyridine-1-carbonyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CC=CCC2)C1 |
| InChI | InChI=1S/C12H17NO3/c14-11(13-6-2-1-3-7-13)9-4-5-10(8-9)12(15)16/h1-2,9-10H,3-8H2,(H,15,16) |
| InChIKey | QGXJTGXKLYDETH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|