C20H22Cl2N2O5S — CID 166180095
4-[2-chloro-4-[(3-chloro-4-pyrrolidin-1-ylphenyl)sulfamoyl]phenoxy]butanoic acid (PubChem CID 166180095) has the molecular formula C20H22Cl2N2O5S and a molecular weight of 473.38 g/mol. Its IUPAC name is 4-[2-chloro-4-[(3-chloro-4-pyrrolidin-1-ylphenyl)sulfamoyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-chloro-4-[(3-chloro-4-pyrrolidin-1-ylphenyl)sulfamoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 166180095 |
| Molecular Formula | C20H22Cl2N2O5S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 4-[2-chloro-4-[(3-chloro-4-pyrrolidin-1-ylphenyl)sulfamoyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(S(=O)(=O)Nc2ccc(N3CCCC3)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O5S/c21-16-12-14(5-7-18(16)24-9-1-2-10-24)23-30(27,28)15-6-8-19(17(22)13-15)29-11-3-4-20(25)26/h5-8,12-13,23H,1-4,9-11H2,(H,25,26) |
| InChIKey | RKOXEVGBWQFFGV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|