C18H25N3O5S — CID 166181956
tert-butyl N-[1-[(3-cyanophenyl)sulfonylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 166181956) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is tert-butyl N-[1-[(3-cyanophenyl)sulfonylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(3-cyanophenyl)sulfonylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 166181956 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | tert-butyl N-[1-[(3-cyanophenyl)sulfonylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)NS(=O)(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C18H25N3O5S/c1-12(2)9-15(20-17(23)26-18(3,4)5)16(22)21-27(24,25)14-8-6-7-13(10-14)11-19/h6-8,10,12,15H,9H2,1-5H3,(H,20,23)(H,21,22) |
| InChIKey | JRUCEFTVXVITCY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |