About [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate
[(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate (PubChem CID 166182693) has the molecular formula C16H14BrClN2O3S
and a molecular weight of 429.72 g/mol. Its IUPAC name is [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate |
| PubChem CID | 166182693 |
| Molecular Formula | C16H14BrClN2O3S |
| Molecular Weight | 429.72 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate |
| SMILES | C[C@H](OC(=O)C1CC(=O)N(c2nccs2)C1)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C16H14BrClN2O3S/c1-9(10-2-3-13(18)12(17)6-10)23-15(22)11-7-14(21)20(8-11)16-19-4-5-24-16/h2-6,9,11H,7-8H2,1H3/t9-,11?/m0/s1 |
| InChIKey | DMGJCSFSANEGMD-FTNKSUMCSA-N |
| XLogP | 4.22 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate?
The IUPAC name of [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate (CID 166182693) is [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate.
What is the SMILES notation for [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate?
The canonical SMILES for [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate is C[C@H](OC(=O)C1CC(=O)N(c2nccs2)C1)c1ccc(Cl)c(Br)c1.
What is the InChIKey of [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate?
The InChIKey is DMGJCSFSANEGMD-FTNKSUMCSA-N. The full InChI is InChI=1S/C16H14BrClN2O3S/c1-9(10-2-3-13(18)12(17)6-10)23-15(22)11-7-14(21)20(8-11)16-19-4-5-24-16/h2-6,9,11H,7-8H2,1H3/t9-,11?/m0/s1.
What are the key properties of [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate?
[(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate has a molecular weight of 429.72 g/mol, XLogP of 4.22, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(3-bromo-4-chlorophenyl)ethyl] 5-oxo-1-(1,3-thiazol-2-yl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 166182693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).