C12H10BrCl2NO3 — CID 168694777
methyl 1-(4-bromo-3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168694777) has the molecular formula C12H10BrCl2NO3 and a molecular weight of 367.03 g/mol. Its IUPAC name is methyl 1-(4-bromo-3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(4-bromo-3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168694777 |
| Molecular Formula | C12H10BrCl2NO3 |
| Molecular Weight | 367.03 g/mol |
| Exact Mass | 364.92 |
| IUPAC Name | methyl 1-(4-bromo-3,5-dichlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2cc(Cl)c(Br)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H10BrCl2NO3/c1-19-12(18)6-2-10(17)16(5-6)7-3-8(14)11(13)9(15)4-7/h3-4,6H,2,5H2,1H3 |
| InChIKey | AJMHBEXEPBUGCX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.03 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|