C14H16INO3 — CID 94068737
methyl (3R)-1-(4-iodo-3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 94068737) has the molecular formula C14H16INO3 and a molecular weight of 373.19 g/mol. Its IUPAC name is methyl (3R)-1-(4-iodo-3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3R)-1-(4-iodo-3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 94068737 |
| Molecular Formula | C14H16INO3 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | methyl (3R)-1-(4-iodo-3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(=O)N(c2cc(C)c(I)c(C)c2)C1 |
| InChI | InChI=1S/C14H16INO3/c1-8-4-11(5-9(2)13(8)15)16-7-10(6-12(16)17)14(18)19-3/h4-5,10H,6-7H2,1-3H3/t10-/m1/s1 |
| InChIKey | HGLUKKSRRYSUHC-SNVBAGLBSA-N |
| XLogP | 2.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|