C24H27N3O3 — CID 166183660
1-(1,4-dihydroxy-4-phenylbutan-2-yl)-3-[1-(4-pyridin-4-ylphenyl)ethyl]urea (PubChem CID 166183660) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-(1,4-dihydroxy-4-phenylbutan-2-yl)-3-[1-(4-pyridin-4-ylphenyl)ethyl]urea.
| Compound Name | 1-(1,4-dihydroxy-4-phenylbutan-2-yl)-3-[1-(4-pyridin-4-ylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 166183660 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-(1,4-dihydroxy-4-phenylbutan-2-yl)-3-[1-(4-pyridin-4-ylphenyl)ethyl]urea |
| SMILES | CC(NC(=O)NC(CO)CC(O)c1ccccc1)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-17(18-7-9-19(10-8-18)20-11-13-25-14-12-20)26-24(30)27-22(16-28)15-23(29)21-5-3-2-4-6-21/h2-14,17,22-23,28-29H,15-16H2,1H3,(H2,26,27,30) |
| InChIKey | VLMDZWUUQUNHAS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |