C20H21Cl2NO6 — CID 166184116
[1-(3,5-dichlorophenyl)-2-methoxy-2-oxoethyl] 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 166184116) has the molecular formula C20H21Cl2NO6 and a molecular weight of 442.30 g/mol. Its IUPAC name is [1-(3,5-dichlorophenyl)-2-methoxy-2-oxoethyl] 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | [1-(3,5-dichlorophenyl)-2-methoxy-2-oxoethyl] 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 166184116 |
| Molecular Formula | C20H21Cl2NO6 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | [1-(3,5-dichlorophenyl)-2-methoxy-2-oxoethyl] 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | COC(=O)C(OC(=O)CCN1C(=O)C2CCCCC2C1=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2NO6/c1-28-20(27)17(11-8-12(21)10-13(22)9-11)29-16(24)6-7-23-18(25)14-4-2-3-5-15(14)19(23)26/h8-10,14-15,17H,2-7H2,1H3 |
| InChIKey | OUGKUANATLVYGX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|