C17H17Cl2N3O2 — CID 166184268
2-[[1-[2-(2,4-dichlorophenoxy)ethyl]benzimidazol-2-yl]amino]ethanol (PubChem CID 166184268) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 2-[[1-[2-(2,4-dichlorophenoxy)ethyl]benzimidazol-2-yl]amino]ethanol.
| Compound Name | 2-[[1-[2-(2,4-dichlorophenoxy)ethyl]benzimidazol-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 166184268 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-[[1-[2-(2,4-dichlorophenoxy)ethyl]benzimidazol-2-yl]amino]ethanol |
| SMILES | OCCNc1nc2ccccc2n1CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O2/c18-12-5-6-16(13(19)11-12)24-10-8-22-15-4-2-1-3-14(15)21-17(22)20-7-9-23/h1-6,11,23H,7-10H2,(H,20,21) |
| InChIKey | DQRHSXYMFPMMQG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |