C16H15ClFN3O — CID 154746527
2-[[1-[(3-chloro-2-fluorophenyl)methyl]benzimidazol-2-yl]amino]ethanol (PubChem CID 154746527) has the molecular formula C16H15ClFN3O and a molecular weight of 319.77 g/mol. Its IUPAC name is 2-[[1-[(3-chloro-2-fluorophenyl)methyl]benzimidazol-2-yl]amino]ethanol.
| Compound Name | 2-[[1-[(3-chloro-2-fluorophenyl)methyl]benzimidazol-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 154746527 |
| Molecular Formula | C16H15ClFN3O |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-[[1-[(3-chloro-2-fluorophenyl)methyl]benzimidazol-2-yl]amino]ethanol |
| SMILES | OCCNc1nc2ccccc2n1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C16H15ClFN3O/c17-12-5-3-4-11(15(12)18)10-21-14-7-2-1-6-13(14)20-16(21)19-8-9-22/h1-7,22H,8-10H2,(H,19,20) |
| InChIKey | YAFVKVLPIQHZPW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |